| Name | Bis(carboxymethyl) trithiocarbonate |
| Synonyms | AKOS BBS-00000843 TIMTEC-BB SBB000667 (Thiocarbonyl)bisthiodiacetic acid BIS(CARBOXYMETHYL) TRITHIOCARBONATE Bis(carboxymethyl) trithiocarbonate [(Thiocarbonyl)bisthio]diacetic acid 3,5-dithia-4-thioxo-1,7-heptanedioic acid 2,2'-(carbonothioyldisulfanediyl)diacetate TRITHIOCARBONIC ACID BIS(CARBOXYMETHYL) ESTER 2,2'-(carbonothioyldisulfanediyl)diacetic acid (([(CARBOXYMETHYL)SULFANYL]CARBOTHIOYL)SULFANYL)ACETIC ACID |
| CAS | 6326-83-6 |
| EINECS | 228-693-7 |
| InChI | InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | GQECANUIPBFPLA-UHFFFAOYSA-N |
| Molecular Formula | C5H6O4S3 |
| Molar Mass | 226.29 |
| Density | 1.513 (estimate) |
| Melting Point | 172-175 °C (lit.) |
| Boling Point | 337.91°C (rough estimate) |
| Flash Point | 275.9°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 9.26E-13mmHg at 25°C |
| Appearance | solid |
| Color | Yellow |
| BRN | 1785452 |
| pKa | 2.53±0.10(Predicted) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.4360 (estimate) |
| MDL | MFCD00004357 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29309099 |